C15H18F3NOS — CID 63520358
2-(cyclohexylmethoxy)-5-(trifluoromethyl)benzenecarbothioamide (PubChem CID 63520358) has the molecular formula C15H18F3NOS and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-(cyclohexylmethoxy)-5-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 2-(cyclohexylmethoxy)-5-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 63520358 |
| Molecular Formula | C15H18F3NOS |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-(cyclohexylmethoxy)-5-(trifluoromethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(C(F)(F)F)ccc1OCC1CCCCC1 |
| InChI | InChI=1S/C15H18F3NOS/c16-15(17,18)11-6-7-13(12(8-11)14(19)21)20-9-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H2,19,21) |
| InChIKey | MBNKVDIFZBTZQB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|