C11H9F6NOS — CID 82956237
5-(trifluoromethyl)-2-(3,3,3-trifluoropropoxy)benzenecarbothioamide (PubChem CID 82956237) has the molecular formula C11H9F6NOS and a molecular weight of 317.25 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-(3,3,3-trifluoropropoxy)benzenecarbothioamide.
| Compound Name | 5-(trifluoromethyl)-2-(3,3,3-trifluoropropoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 82956237 |
| Molecular Formula | C11H9F6NOS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-(trifluoromethyl)-2-(3,3,3-trifluoropropoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(C(F)(F)F)ccc1OCCC(F)(F)F |
| InChI | InChI=1S/C11H9F6NOS/c12-10(13,14)3-4-19-8-2-1-6(11(15,16)17)5-7(8)9(18)20/h1-2,5H,3-4H2,(H2,18,20) |
| InChIKey | MKPDCYPOXKHZJY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|