C14H17F3O3 — CID 66225523
2-(3,3-dimethylbutoxy)-5-(trifluoromethyl)benzoic acid (PubChem CID 66225523) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(3,3-dimethylbutoxy)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 66225523 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-5-(trifluoromethyl)benzoic acid |
| SMILES | CC(C)(C)CCOc1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C14H17F3O3/c1-13(2,3)6-7-20-11-5-4-9(14(15,16)17)8-10(11)12(18)19/h4-5,8H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | PDPGVAQMMAYYDA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |