C13H15F3O5 — CID 104560463
2-[2-(2-methoxyethoxy)ethoxy]-5-(trifluoromethyl)benzoic acid (PubChem CID 104560463) has the molecular formula C13H15F3O5 and a molecular weight of 308.25 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 104560463 |
| Molecular Formula | C13H15F3O5 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]-5-(trifluoromethyl)benzoic acid |
| SMILES | COCCOCCOc1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C13H15F3O5/c1-19-4-5-20-6-7-21-11-3-2-9(13(14,15)16)8-10(11)12(17)18/h2-3,8H,4-7H2,1H3,(H,17,18) |
| InChIKey | ZEXSRBDYAHHYMV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|