C11H11F3O3S — CID 62700951
2-(2-methoxyethylsulfanyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 62700951) has the molecular formula C11H11F3O3S and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfanyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(2-methoxyethylsulfanyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 62700951 |
| Molecular Formula | C11H11F3O3S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-(2-methoxyethylsulfanyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | COCCSc1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C11H11F3O3S/c1-17-4-5-18-9-3-2-7(11(12,13)14)6-8(9)10(15)16/h2-3,6H,4-5H2,1H3,(H,15,16) |
| InChIKey | CNGQQWLHVKYBHT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|