C16H10F6O3S — CID 88838606
5-(trifluoromethoxy)-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]benzoic acid (PubChem CID 88838606) has the molecular formula C16H10F6O3S and a molecular weight of 396.31 g/mol. Its IUPAC name is 5-(trifluoromethoxy)-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]benzoic acid.
| Compound Name | 5-(trifluoromethoxy)-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 88838606 |
| Molecular Formula | C16H10F6O3S |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 5-(trifluoromethoxy)-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1cc(OC(F)(F)F)ccc1SCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F6O3S/c17-15(18,19)10-3-1-9(2-4-10)8-26-13-6-5-11(25-16(20,21)22)7-12(13)14(23)24/h1-7H,8H2,(H,23,24) |
| InChIKey | QSMNZYJGCBAQOI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |