C11H13F3O3Si — CID 167714402
5-(trifluoromethyl)-2-trimethylsilyloxybenzoic acid (PubChem CID 167714402) has the molecular formula C11H13F3O3Si and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-trimethylsilyloxybenzoic acid.
| Compound Name | 5-(trifluoromethyl)-2-trimethylsilyloxybenzoic acid |
|---|---|
| PubChem CID | 167714402 |
| Molecular Formula | C11H13F3O3Si |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-(trifluoromethyl)-2-trimethylsilyloxybenzoic acid |
| SMILES | C[Si](C)(C)Oc1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C11H13F3O3Si/c1-18(2,3)17-9-5-4-7(11(12,13)14)6-8(9)10(15)16/h4-6H,1-3H3,(H,15,16) |
| InChIKey | GDLXDXCLKIRTSB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|