C10H6BrF5O2 — CID 146009299
2-bromo-2,2-difluoro-1-[2-methoxy-5-(trifluoromethyl)phenyl]ethanone (PubChem CID 146009299) has the molecular formula C10H6BrF5O2 and a molecular weight of 333.05 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-1-[2-methoxy-5-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-bromo-2,2-difluoro-1-[2-methoxy-5-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 146009299 |
| Molecular Formula | C10H6BrF5O2 |
| Molecular Weight | 333.05 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 2-bromo-2,2-difluoro-1-[2-methoxy-5-(trifluoromethyl)phenyl]ethanone |
| SMILES | COc1ccc(C(F)(F)F)cc1C(=O)C(F)(F)Br |
| InChI | InChI=1S/C10H6BrF5O2/c1-18-7-3-2-5(10(14,15)16)4-6(7)8(17)9(11,12)13/h2-4H,1H3 |
| InChIKey | HHLZXMNBSWWLKL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.05 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|