C12H11F3O4 — CID 82262810
4-[2-methoxy-5-(trifluoromethyl)phenyl]-4-oxobutanoic acid (PubChem CID 82262810) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is 4-[2-methoxy-5-(trifluoromethyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[2-methoxy-5-(trifluoromethyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82262810 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-[2-methoxy-5-(trifluoromethyl)phenyl]-4-oxobutanoic acid |
| SMILES | COc1ccc(C(F)(F)F)cc1C(=O)CCC(=O)O |
| InChI | InChI=1S/C12H11F3O4/c1-19-10-4-2-7(12(13,14)15)6-8(10)9(16)3-5-11(17)18/h2,4,6H,3,5H2,1H3,(H,17,18) |
| InChIKey | UAZOWEYJYVOLFW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |