C13H16O4 — CID 82049173
4-(2-methoxy-4,5-dimethylphenyl)-4-oxobutanoic acid (PubChem CID 82049173) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(2-methoxy-4,5-dimethylphenyl)-4-oxobutanoic acid.
| Compound Name | 4-(2-methoxy-4,5-dimethylphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82049173 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(2-methoxy-4,5-dimethylphenyl)-4-oxobutanoic acid |
| SMILES | COc1cc(C)c(C)cc1C(=O)CCC(=O)O |
| InChI | InChI=1S/C13H16O4/c1-8-6-10(11(14)4-5-13(15)16)12(17-3)7-9(8)2/h6-7H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | VLKRHDMOZVGEEW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |