4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid

C12H14O6 — CID 162958445

IUPAC4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid
SMILESCOc1cc(C(=O)CCC(=O)O)c(O)c(O)c1C
InChIInChI=1S/C12H14O6/c1-6-9(18-2)5-7(12(17)11(6)16)8(13)3-4-10(14)15/h5,16-17H,3-4H2,1-2H3,(H,14,15)
InChIKeyUYCRMOLFHHCNID-UHFFFAOYSA-N
MW254.24 g/mol
LogP1.46
Rot. Bonds5

About 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid

4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid (PubChem CID 162958445) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid
PubChem CID162958445
Molecular FormulaC12H14O6
Molecular Weight254.24 g/mol
Exact Mass254.08
IUPAC Name4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid
SMILESCOc1cc(C(=O)CCC(=O)O)c(O)c(O)c1C
InChIInChI=1S/C12H14O6/c1-6-9(18-2)5-7(12(17)11(6)16)8(13)3-4-10(14)15/h5,16-17H,3-4H2,1-2H3,(H,14,15)
InChIKeyUYCRMOLFHHCNID-UHFFFAOYSA-N
XLogP1.46
TPSA104.06 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.24
LogP ≤ 51.46
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid?
The IUPAC name of 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid (CID 162958445) is 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid.
What is the SMILES notation for 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid?
The canonical SMILES for 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid is COc1cc(C(=O)CCC(=O)O)c(O)c(O)c1C.
What is the InChIKey of 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid?
The InChIKey is UYCRMOLFHHCNID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O6/c1-6-9(18-2)5-7(12(17)11(6)16)8(13)3-4-10(14)15/h5,16-17H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid?
4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid has a molecular weight of 254.24 g/mol, XLogP of 1.46, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid is sourced from PubChem (CID 162958445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).