C12H14O6 — CID 162958445
4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid (PubChem CID 162958445) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid.
| Compound Name | 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 162958445 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-(2,3-dihydroxy-5-methoxy-4-methylphenyl)-4-oxobutanoic acid |
| SMILES | COc1cc(C(=O)CCC(=O)O)c(O)c(O)c1C |
| InChI | InChI=1S/C12H14O6/c1-6-9(18-2)5-7(12(17)11(6)16)8(13)3-4-10(14)15/h5,16-17H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | UYCRMOLFHHCNID-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|