C14H18O5 — CID 116919180
methyl 4-(4,5-dimethoxy-2-methylphenyl)-4-oxobutanoate (PubChem CID 116919180) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is methyl 4-(4,5-dimethoxy-2-methylphenyl)-4-oxobutanoate.
| Compound Name | methyl 4-(4,5-dimethoxy-2-methylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 116919180 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | methyl 4-(4,5-dimethoxy-2-methylphenyl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C14H18O5/c1-9-7-12(17-2)13(18-3)8-10(9)11(15)5-6-14(16)19-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | SAYFVFVXVWBDAO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |