C13H19NO3 — CID 116915618
3-amino-1-(4,5-dimethoxy-2-methylphenyl)butan-1-one (PubChem CID 116915618) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-amino-1-(4,5-dimethoxy-2-methylphenyl)butan-1-one.
| Compound Name | 3-amino-1-(4,5-dimethoxy-2-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 116915618 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3-amino-1-(4,5-dimethoxy-2-methylphenyl)butan-1-one |
| SMILES | COc1cc(C)c(C(=O)CC(C)N)cc1OC |
| InChI | InChI=1S/C13H19NO3/c1-8-5-12(16-3)13(17-4)7-10(8)11(15)6-9(2)14/h5,7,9H,6,14H2,1-4H3 |
| InChIKey | YHTSGQOIWWNLGJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |