About 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid
4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid (PubChem CID 116918300) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid.
Analyze 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid?
The IUPAC name of 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid (CID 116918300) is 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid?
The canonical SMILES for 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid is COc1cc(C)c(C(=O)C(C)CC(=O)O)cc1OC.
What is the InChIKey of 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid?
The InChIKey is VBGKOGIKPPLGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5/c1-8-5-11(18-3)12(19-4)7-10(8)14(17)9(2)6-13(15)16/h5,7,9H,6H2,1-4H3,(H,15,16).
What are the key properties of 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid?
4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid has a molecular weight of 266.29 g/mol, XLogP of 2.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethoxy-2-methylphenyl)-3-methyl-4-oxobutanoic acid is sourced from PubChem (CID 116918300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).