C17H19NO4 — CID 71567292
(3S)-4-(2-ethyl-8-methoxyquinolin-5-yl)-3-methyl-4-oxobutanoic acid (PubChem CID 71567292) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (3S)-4-(2-ethyl-8-methoxyquinolin-5-yl)-3-methyl-4-oxobutanoic acid.
| Compound Name | (3S)-4-(2-ethyl-8-methoxyquinolin-5-yl)-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71567292 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (3S)-4-(2-ethyl-8-methoxyquinolin-5-yl)-3-methyl-4-oxobutanoic acid |
| SMILES | CCc1ccc2c(C(=O)[C@@H](C)CC(=O)O)ccc(OC)c2n1 |
| InChI | InChI=1S/C17H19NO4/c1-4-11-5-6-12-13(17(21)10(2)9-15(19)20)7-8-14(22-3)16(12)18-11/h5-8,10H,4,9H2,1-3H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | BPLXXFYULLAWGL-JTQLQIEISA-N |
| XLogP | 3.10 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |