C11H13BrO3 — CID 15643655
2-bromo-1-(4,5-dimethoxy-2-methylphenyl)ethanone (PubChem CID 15643655) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-bromo-1-(4,5-dimethoxy-2-methylphenyl)ethanone.
| Compound Name | 2-bromo-1-(4,5-dimethoxy-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 15643655 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-bromo-1-(4,5-dimethoxy-2-methylphenyl)ethanone |
| SMILES | COc1cc(C)c(C(=O)CBr)cc1OC |
| InChI | InChI=1S/C11H13BrO3/c1-7-4-10(14-2)11(15-3)5-8(7)9(13)6-12/h4-5H,6H2,1-3H3 |
| InChIKey | BOVXDCXSZMYRDZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|