C10H10Br2O3 — CID 86014406
2-bromo-1-(4-bromo-2,5-dimethoxyphenyl)ethanone (PubChem CID 86014406) has the molecular formula C10H10Br2O3 and a molecular weight of 338.00 g/mol. Its IUPAC name is 2-bromo-1-(4-bromo-2,5-dimethoxyphenyl)ethanone.
| Compound Name | 2-bromo-1-(4-bromo-2,5-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 86014406 |
| Molecular Formula | C10H10Br2O3 |
| Molecular Weight | 338.00 g/mol |
| Exact Mass | 335.90 |
| IUPAC Name | 2-bromo-1-(4-bromo-2,5-dimethoxyphenyl)ethanone |
| SMILES | COc1cc(C(=O)CBr)c(OC)cc1Br |
| InChI | InChI=1S/C10H10Br2O3/c1-14-9-4-7(12)10(15-2)3-6(9)8(13)5-11/h3-4H,5H2,1-2H3 |
| InChIKey | DQVKFZDHKLHBDR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.00 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|