C17H20O5Zn — CID 67884422
4-(3,6-dimethoxy-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-4-oxobutanoic acid;zinc (PubChem CID 67884422) has the molecular formula C17H20O5Zn and a molecular weight of 369.73 g/mol. Its IUPAC name is 4-(3,6-dimethoxy-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-4-oxobutanoic acid;zinc.
| Compound Name | 4-(3,6-dimethoxy-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-4-oxobutanoic acid;zinc |
|---|---|
| PubChem CID | 67884422 |
| Molecular Formula | C17H20O5Zn |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-(3,6-dimethoxy-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-4-oxobutanoic acid;zinc |
| SMILES | COc1cc(C(=O)CCC(=O)O)c(OC)c2c1C1CCC2C1.[Zn] |
| InChI | InChI=1S/C17H20O5.Zn/c1-21-13-8-11(12(18)5-6-14(19)20)17(22-2)16-10-4-3-9(7-10)15(13)16;/h8-10H,3-7H2,1-2H3,(H,19,20); |
| InChIKey | WDYCOZVMVPCPRR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|