C10H9BrF2O3 — CID 146006289
2-bromo-1-(2,5-dimethoxyphenyl)-2,2-difluoroethanone (PubChem CID 146006289) has the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. Its IUPAC name is 2-bromo-1-(2,5-dimethoxyphenyl)-2,2-difluoroethanone.
| Compound Name | 2-bromo-1-(2,5-dimethoxyphenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 146006289 |
| Molecular Formula | C10H9BrF2O3 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 2-bromo-1-(2,5-dimethoxyphenyl)-2,2-difluoroethanone |
| SMILES | COc1ccc(OC)c(C(=O)C(F)(F)Br)c1 |
| InChI | InChI=1S/C10H9BrF2O3/c1-15-6-3-4-8(16-2)7(5-6)9(14)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | VHKJQBOVYYLLHB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|