C11H11F3O5 — CID 63899578
5-methoxy-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid (PubChem CID 63899578) has the molecular formula C11H11F3O5 and a molecular weight of 280.20 g/mol. Its IUPAC name is 5-methoxy-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid.
| Compound Name | 5-methoxy-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid |
|---|---|
| PubChem CID | 63899578 |
| Molecular Formula | C11H11F3O5 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-methoxy-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid |
| SMILES | COc1ccc(OCC(O)C(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H11F3O5/c1-18-6-2-3-8(7(4-6)10(16)17)19-5-9(15)11(12,13)14/h2-4,9,15H,5H2,1H3,(H,16,17) |
| InChIKey | VKVJYCNADRIJJK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |