5-methoxy-2-(2-methylidenebutoxy)benzoic acid

C13H16O4 — CID 66047074

IUPAC5-methoxy-2-(2-methylidenebutoxy)benzoic acid
SMILESC=C(CC)COc1ccc(OC)cc1C(=O)O
InChIInChI=1S/C13H16O4/c1-4-9(2)8-17-12-6-5-10(16-3)7-11(12)13(14)15/h5-7H,2,4,8H2,1,3H3,(H,14,15)
InChIKeyQBKVRFGFZFZTSI-UHFFFAOYSA-N
MW236.27 g/mol
LogP2.74
Rot. Bonds6

About 5-methoxy-2-(2-methylidenebutoxy)benzoic acid

5-methoxy-2-(2-methylidenebutoxy)benzoic acid (PubChem CID 66047074) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-methoxy-2-(2-methylidenebutoxy)benzoic acid.

Molecular Properties

Compound Name5-methoxy-2-(2-methylidenebutoxy)benzoic acid
PubChem CID66047074
Molecular FormulaC13H16O4
Molecular Weight236.27 g/mol
Exact Mass236.10
IUPAC Name5-methoxy-2-(2-methylidenebutoxy)benzoic acid
SMILESC=C(CC)COc1ccc(OC)cc1C(=O)O
InChIInChI=1S/C13H16O4/c1-4-9(2)8-17-12-6-5-10(16-3)7-11(12)13(14)15/h5-7H,2,4,8H2,1,3H3,(H,14,15)
InChIKeyQBKVRFGFZFZTSI-UHFFFAOYSA-N
XLogP2.74
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5-methoxy-2-(2-methylidenebutoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-butoxy-5-methoxybenzoic acid
CID 43213162
2-[2-[ethyl(methyl)amino]-2-oxoethoxy]-5-methoxybenzoic acid
CID 43309744
2-(2,3-dichloroprop-2-enoxy)-5-methoxybenzoic acid
CID 79167882
5-methoxy-2-(3-methylbut-3-enoxy)benzoic acid
CID 114471317
2-(2-bromoprop-2-enoxy)-4-methoxybenzoic acid
CID 61379603
4-chloro-2-(2-methylidenebutoxy)benzoic acid
CID 66046369
5-methoxy-2-[2-oxo-2-(prop-2-enylamino)ethoxy]benzoic acid
CID 45304182
5-methoxy-2-[2-(2-methylbutan-2-ylamino)-2-oxoethoxy]benzoic acid
CID 60693177
2-(3-hydroxypropoxy)-5-methoxybenzoic acid
CID 60693366
5-methoxy-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)benzoic acid
CID 79624210
5-methoxy-2-(2-methylprop-2-enoxy)benzoyl fluoride
CID 177477124
5-methoxy-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid
CID 63899578

Frequently Asked Questions

What is the IUPAC name of 5-methoxy-2-(2-methylidenebutoxy)benzoic acid?
The IUPAC name of 5-methoxy-2-(2-methylidenebutoxy)benzoic acid (CID 66047074) is 5-methoxy-2-(2-methylidenebutoxy)benzoic acid.
What is the SMILES notation for 5-methoxy-2-(2-methylidenebutoxy)benzoic acid?
The canonical SMILES for 5-methoxy-2-(2-methylidenebutoxy)benzoic acid is C=C(CC)COc1ccc(OC)cc1C(=O)O.
What is the InChIKey of 5-methoxy-2-(2-methylidenebutoxy)benzoic acid?
The InChIKey is QBKVRFGFZFZTSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-4-9(2)8-17-12-6-5-10(16-3)7-11(12)13(14)15/h5-7H,2,4,8H2,1,3H3,(H,14,15).
What are the key properties of 5-methoxy-2-(2-methylidenebutoxy)benzoic acid?
5-methoxy-2-(2-methylidenebutoxy)benzoic acid has a molecular weight of 236.27 g/mol, XLogP of 2.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-(2-methylidenebutoxy)benzoic acid is sourced from PubChem (CID 66047074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).