C13H17NO5 — CID 43309744
2-[2-[ethyl(methyl)amino]-2-oxoethoxy]-5-methoxybenzoic acid (PubChem CID 43309744) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[2-[ethyl(methyl)amino]-2-oxoethoxy]-5-methoxybenzoic acid.
| Compound Name | 2-[2-[ethyl(methyl)amino]-2-oxoethoxy]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 43309744 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[2-[ethyl(methyl)amino]-2-oxoethoxy]-5-methoxybenzoic acid |
| SMILES | CCN(C)C(=O)COc1ccc(OC)cc1C(=O)O |
| InChI | InChI=1S/C13H17NO5/c1-4-14(2)12(15)8-19-11-6-5-9(18-3)7-10(11)13(16)17/h5-7H,4,8H2,1-3H3,(H,16,17) |
| InChIKey | LNSUTRFCDPIHJO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |