C10H8F4O4 — CID 107014268
4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid (PubChem CID 107014268) has the molecular formula C10H8F4O4 and a molecular weight of 268.16 g/mol. Its IUPAC name is 4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid.
| Compound Name | 4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid |
|---|---|
| PubChem CID | 107014268 |
| Molecular Formula | C10H8F4O4 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 4-fluoro-2-(3,3,3-trifluoro-2-hydroxypropoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(F)cc1OCC(O)C(F)(F)F |
| InChI | InChI=1S/C10H8F4O4/c11-5-1-2-6(9(16)17)7(3-5)18-4-8(15)10(12,13)14/h1-3,8,15H,4H2,(H,16,17) |
| InChIKey | BYOYOEPAZMJTQS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |