C13H17FO5 — CID 107014327
4-fluoro-2-(2-hydroxy-3-propan-2-yloxypropoxy)benzoic acid (PubChem CID 107014327) has the molecular formula C13H17FO5 and a molecular weight of 272.27 g/mol. Its IUPAC name is 4-fluoro-2-(2-hydroxy-3-propan-2-yloxypropoxy)benzoic acid.
| Compound Name | 4-fluoro-2-(2-hydroxy-3-propan-2-yloxypropoxy)benzoic acid |
|---|---|
| PubChem CID | 107014327 |
| Molecular Formula | C13H17FO5 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-fluoro-2-(2-hydroxy-3-propan-2-yloxypropoxy)benzoic acid |
| SMILES | CC(C)OCC(O)COc1cc(F)ccc1C(=O)O |
| InChI | InChI=1S/C13H17FO5/c1-8(2)18-6-10(15)7-19-12-5-9(14)3-4-11(12)13(16)17/h3-5,8,10,15H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | RUUFEQVGHIFTHX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |