C12H16ClFO3 — CID 71943765
1-(2-chloro-4-fluorophenoxy)-3-propan-2-yloxypropan-2-ol (PubChem CID 71943765) has the molecular formula C12H16ClFO3 and a molecular weight of 262.71 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenoxy)-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-(2-chloro-4-fluorophenoxy)-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 71943765 |
| Molecular Formula | C12H16ClFO3 |
| Molecular Weight | 262.71 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-(2-chloro-4-fluorophenoxy)-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)COc1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H16ClFO3/c1-8(2)16-6-10(15)7-17-12-4-3-9(14)5-11(12)13/h3-5,8,10,15H,6-7H2,1-2H3 |
| InChIKey | QRZMYIRQBHCFSM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.71 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |