C13H16FNO3 — CID 103849787
3-fluoro-4-(2-hydroxy-3-propan-2-yloxypropoxy)benzonitrile (PubChem CID 103849787) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 3-fluoro-4-(2-hydroxy-3-propan-2-yloxypropoxy)benzonitrile.
| Compound Name | 3-fluoro-4-(2-hydroxy-3-propan-2-yloxypropoxy)benzonitrile |
|---|---|
| PubChem CID | 103849787 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-fluoro-4-(2-hydroxy-3-propan-2-yloxypropoxy)benzonitrile |
| SMILES | CC(C)OCC(O)COc1ccc(C#N)cc1F |
| InChI | InChI=1S/C13H16FNO3/c1-9(2)17-7-11(16)8-18-13-4-3-10(6-15)5-12(13)14/h3-5,9,11,16H,7-8H2,1-2H3 |
| InChIKey | ZJTOQBRZCYOSFD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |