C14H22ClNO3 — CID 63988427
1-[2-[(1R)-1-aminoethyl]-4-chlorophenoxy]-3-propan-2-yloxypropan-2-ol (PubChem CID 63988427) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 1-[2-[(1R)-1-aminoethyl]-4-chlorophenoxy]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[2-[(1R)-1-aminoethyl]-4-chlorophenoxy]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 63988427 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-[2-[(1R)-1-aminoethyl]-4-chlorophenoxy]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)COc1ccc(Cl)cc1[C@@H](C)N |
| InChI | InChI=1S/C14H22ClNO3/c1-9(2)18-7-12(17)8-19-14-5-4-11(15)6-13(14)10(3)16/h4-6,9-10,12,17H,7-8,16H2,1-3H3/t10-,12?/m1/s1 |
| InChIKey | DEZJJONKQCDGOQ-RWANSRKNSA-N |
| XLogP | 2.52 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |