C9H6BrClF2O2 — CID 130136738
2-bromo-1-(2-chloro-5-methoxyphenyl)-2,2-difluoroethanone (PubChem CID 130136738) has the molecular formula C9H6BrClF2O2 and a molecular weight of 299.50 g/mol. Its IUPAC name is 2-bromo-1-(2-chloro-5-methoxyphenyl)-2,2-difluoroethanone.
| Compound Name | 2-bromo-1-(2-chloro-5-methoxyphenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130136738 |
| Molecular Formula | C9H6BrClF2O2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | 2-bromo-1-(2-chloro-5-methoxyphenyl)-2,2-difluoroethanone |
| SMILES | COc1ccc(Cl)c(C(=O)C(F)(F)Br)c1 |
| InChI | InChI=1S/C9H6BrClF2O2/c1-15-5-2-3-7(11)6(4-5)8(14)9(10,12)13/h2-4H,1H3 |
| InChIKey | YKGOEXJAXKIWEE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|