C17H17F3O3Si — CID 167719114
5-[3-(trifluoromethyl)phenyl]-2-trimethylsilyloxybenzoic acid (PubChem CID 167719114) has the molecular formula C17H17F3O3Si and a molecular weight of 354.40 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)phenyl]-2-trimethylsilyloxybenzoic acid.
| Compound Name | 5-[3-(trifluoromethyl)phenyl]-2-trimethylsilyloxybenzoic acid |
|---|---|
| PubChem CID | 167719114 |
| Molecular Formula | C17H17F3O3Si |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-[3-(trifluoromethyl)phenyl]-2-trimethylsilyloxybenzoic acid |
| SMILES | C[Si](C)(C)Oc1ccc(-c2cccc(C(F)(F)F)c2)cc1C(=O)O |
| InChI | InChI=1S/C17H17F3O3Si/c1-24(2,3)23-15-8-7-12(10-14(15)16(21)22)11-5-4-6-13(9-11)17(18,19)20/h4-10H,1-3H3,(H,21,22) |
| InChIKey | ZLULQBNQUDMACT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|