C16H13F3O2 — CID 172876886
2,6-dimethyl-4-[3-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 172876886) has the molecular formula C16H13F3O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2,6-dimethyl-4-[3-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 2,6-dimethyl-4-[3-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 172876886 |
| Molecular Formula | C16H13F3O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2,6-dimethyl-4-[3-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | Cc1cc(-c2cccc(C(F)(F)F)c2)cc(C)c1C(=O)O |
| InChI | InChI=1S/C16H13F3O2/c1-9-6-12(7-10(2)14(9)15(20)21)11-4-3-5-13(8-11)16(17,18)19/h3-8H,1-2H3,(H,20,21) |
| InChIKey | KDDQSQJJMXNNAS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |