C13H9F3NaO3S — CID 131866586
CID 131866586 (PubChem CID 131866586) has the molecular formula C13H9F3NaO3S and a molecular weight of 325.26 g/mol.
| Compound Name | CID 131866586 |
|---|---|
| PubChem CID | 131866586 |
| Molecular Formula | C13H9F3NaO3S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc(-c2cccc(C(F)(F)F)c2)cc1.[Na] |
| InChI | InChI=1S/C13H9F3O3S.Na/c14-13(15,16)11-3-1-2-10(8-11)9-4-6-12(7-5-9)20(17,18)19;/h1-8H,(H,17,18,19); |
| InChIKey | MYUAGARBPGEQIP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|