C11H11F4NO3 — CID 80712032
2-fluoro-N-(2-methoxyethoxy)-5-(trifluoromethyl)benzamide (PubChem CID 80712032) has the molecular formula C11H11F4NO3 and a molecular weight of 281.21 g/mol. Its IUPAC name is 2-fluoro-N-(2-methoxyethoxy)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(2-methoxyethoxy)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 80712032 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-fluoro-N-(2-methoxyethoxy)-5-(trifluoromethyl)benzamide |
| SMILES | COCCONC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H11F4NO3/c1-18-4-5-19-16-10(17)8-6-7(11(13,14)15)2-3-9(8)12/h2-3,6H,4-5H2,1H3,(H,16,17) |
| InChIKey | YXAFHJDBKOCWKP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|