C13H13F4NO — CID 103528233
2-fluoro-N-(3-methylbut-2-enyl)-5-(trifluoromethyl)benzamide (PubChem CID 103528233) has the molecular formula C13H13F4NO and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-fluoro-N-(3-methylbut-2-enyl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(3-methylbut-2-enyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103528233 |
| Molecular Formula | C13H13F4NO |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-fluoro-N-(3-methylbut-2-enyl)-5-(trifluoromethyl)benzamide |
| SMILES | CC(C)=CCNC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H13F4NO/c1-8(2)5-6-18-12(19)10-7-9(13(15,16)17)3-4-11(10)14/h3-5,7H,6H2,1-2H3,(H,18,19) |
| InChIKey | FRJGOOXYDQTGFY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|