C13H14ClF4NO — CID 114306055
N-(4-chloro-2-methylbutyl)-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 114306055) has the molecular formula C13H14ClF4NO and a molecular weight of 311.71 g/mol. Its IUPAC name is N-(4-chloro-2-methylbutyl)-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-(4-chloro-2-methylbutyl)-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 114306055 |
| Molecular Formula | C13H14ClF4NO |
| Molecular Weight | 311.71 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-(4-chloro-2-methylbutyl)-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | CC(CCCl)CNC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H14ClF4NO/c1-8(4-5-14)7-19-12(20)10-6-9(13(16,17)18)2-3-11(10)15/h2-3,6,8H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | LBRWOGLLICZXAE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|