C13H12BrF4NO — CID 115456406
N-[[1-(bromomethyl)cyclopropyl]methyl]-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 115456406) has the molecular formula C13H12BrF4NO and a molecular weight of 354.14 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclopropyl]methyl]-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-(bromomethyl)cyclopropyl]methyl]-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 115456406 |
| Molecular Formula | C13H12BrF4NO |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | N-[[1-(bromomethyl)cyclopropyl]methyl]-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1(CBr)CC1)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H12BrF4NO/c14-6-12(3-4-12)7-19-11(20)9-5-8(13(16,17)18)1-2-10(9)15/h1-2,5H,3-4,6-7H2,(H,19,20) |
| InChIKey | MSDNXNUGMLPXJZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|