C13H12BrClF3NO — CID 115455978
2-bromo-N-[[1-(chloromethyl)cyclopropyl]methyl]-5-(trifluoromethyl)benzamide (PubChem CID 115455978) has the molecular formula C13H12BrClF3NO and a molecular weight of 370.60 g/mol. Its IUPAC name is 2-bromo-N-[[1-(chloromethyl)cyclopropyl]methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-bromo-N-[[1-(chloromethyl)cyclopropyl]methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 115455978 |
| Molecular Formula | C13H12BrClF3NO |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 2-bromo-N-[[1-(chloromethyl)cyclopropyl]methyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1(CCl)CC1)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C13H12BrClF3NO/c14-10-2-1-8(13(16,17)18)5-9(10)11(20)19-7-12(6-15)3-4-12/h1-2,5H,3-4,6-7H2,(H,19,20) |
| InChIKey | NFZVYUWGUQERJA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|