C13H16F4N2O2 — CID 82991096
2-fluoro-N-[2-(2-methoxyethylamino)ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 82991096) has the molecular formula C13H16F4N2O2 and a molecular weight of 308.27 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2-methoxyethylamino)ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-[2-(2-methoxyethylamino)ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 82991096 |
| Molecular Formula | C13H16F4N2O2 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-fluoro-N-[2-(2-methoxyethylamino)ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | COCCNCCNC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H16F4N2O2/c1-21-7-6-18-4-5-19-12(20)10-8-9(13(15,16)17)2-3-11(10)14/h2-3,8,18H,4-7H2,1H3,(H,19,20) |
| InChIKey | VLPFLHVYGXPSRI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|