C11H9F4NO2 — CID 123850842
2-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethylideneamino]acetic acid (PubChem CID 123850842) has the molecular formula C11H9F4NO2 and a molecular weight of 263.19 g/mol. Its IUPAC name is 2-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethylideneamino]acetic acid.
| Compound Name | 2-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethylideneamino]acetic acid |
|---|---|
| PubChem CID | 123850842 |
| Molecular Formula | C11H9F4NO2 |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethylideneamino]acetic acid |
| SMILES | C/C(=N\CC(=O)O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H9F4NO2/c1-6(16-5-10(17)18)8-4-7(11(13,14)15)2-3-9(8)12/h2-4H,5H2,1H3,(H,17,18)/b16-6+ |
| InChIKey | YWHHEEWQZQLYRQ-OMCISZLKSA-N |
| XLogP | 2.74 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|