C9H6F4O2S — CID 154500330
2-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanylacetic acid (PubChem CID 154500330) has the molecular formula C9H6F4O2S and a molecular weight of 254.20 g/mol. Its IUPAC name is 2-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanylacetic acid.
| Compound Name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 154500330 |
| Molecular Formula | C9H6F4O2S |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H6F4O2S/c10-6-2-1-5(9(11,12)13)3-7(6)16-4-8(14)15/h1-3H,4H2,(H,14,15) |
| InChIKey | ZFZOXAVWJAEFFW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |