C10H7F4NO3 — CID 63049503
3-[2-fluoro-5-(trifluoromethyl)anilino]-3-oxopropanoic acid (PubChem CID 63049503) has the molecular formula C10H7F4NO3 and a molecular weight of 265.16 g/mol. Its IUPAC name is 3-[2-fluoro-5-(trifluoromethyl)anilino]-3-oxopropanoic acid.
| Compound Name | 3-[2-fluoro-5-(trifluoromethyl)anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 63049503 |
| Molecular Formula | C10H7F4NO3 |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 3-[2-fluoro-5-(trifluoromethyl)anilino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C10H7F4NO3/c11-6-2-1-5(10(12,13)14)3-7(6)15-8(16)4-9(17)18/h1-3H,4H2,(H,15,16)(H,17,18) |
| InChIKey | MTNZFJPEGTZXKM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|