C10H5F8NO — CID 103733506
2,2,3,3-tetrafluoro-N-[2-fluoro-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 103733506) has the molecular formula C10H5F8NO and a molecular weight of 307.14 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-fluoro-5-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-fluoro-5-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 103733506 |
| Molecular Formula | C10H5F8NO |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-fluoro-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H5F8NO/c11-5-2-1-4(10(16,17)18)3-6(5)19-8(20)9(14,15)7(12)13/h1-3,7H,(H,19,20) |
| InChIKey | VYYXAJLJTWXBEM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|