C12H15ClF4N2O — CID 120559768
4-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]pentanamide;hydrochloride (PubChem CID 120559768) has the molecular formula C12H15ClF4N2O and a molecular weight of 314.71 g/mol. Its IUPAC name is 4-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120559768 |
| Molecular Formula | C12H15ClF4N2O |
| Molecular Weight | 314.71 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]pentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)Nc1cc(C(F)(F)F)ccc1F.Cl |
| InChI | InChI=1S/C12H14F4N2O.ClH/c1-7(17)2-5-11(19)18-10-6-8(12(14,15)16)3-4-9(10)13;/h3-4,6-7H,2,5,17H2,1H3,(H,18,19);1H |
| InChIKey | UKDRBFUTCJLNGN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |