C9H5ClF5NO — CID 113250773
N-(3-chloro-4-fluorophenyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 113250773) has the molecular formula C9H5ClF5NO and a molecular weight of 273.59 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 113250773 |
| Molecular Formula | C9H5ClF5NO |
| Molecular Weight | 273.59 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H5ClF5NO/c10-5-3-4(1-2-6(5)11)16-8(17)9(14,15)7(12)13/h1-3,7H,(H,16,17) |
| InChIKey | PKDPPIGDGQDZFR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|