C10H7ClF5NO — CID 103733439
N-[(3-chloro-4-fluorophenyl)methyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733439) has the molecular formula C10H7ClF5NO and a molecular weight of 287.62 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733439 |
| Molecular Formula | C10H7ClF5NO |
| Molecular Weight | 287.62 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H7ClF5NO/c11-6-3-5(1-2-7(6)12)4-17-9(18)10(15,16)8(13)14/h1-3,8H,4H2,(H,17,18) |
| InChIKey | OWGHTVMYQXGITM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|