C9H10ClFN2O — CID 115603858
1-[(3-chloro-4-fluorophenyl)methyl]-3-methylurea (PubChem CID 115603858) has the molecular formula C9H10ClFN2O and a molecular weight of 216.64 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-3-methylurea.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-methylurea |
|---|---|
| PubChem CID | 115603858 |
| Molecular Formula | C9H10ClFN2O |
| Molecular Weight | 216.64 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H10ClFN2O/c1-12-9(14)13-5-6-2-3-8(11)7(10)4-6/h2-4H,5H2,1H3,(H2,12,13,14) |
| InChIKey | HRVXQMMDDRVLAH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.64 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |