C12H16ClFN2O2 — CID 110922317
1-[(3-chloro-4-fluorophenyl)methyl]-3-(1-hydroxybutan-2-yl)urea (PubChem CID 110922317) has the molecular formula C12H16ClFN2O2 and a molecular weight of 274.72 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 110922317 |
| Molecular Formula | C12H16ClFN2O2 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClFN2O2/c1-2-9(7-17)16-12(18)15-6-8-3-4-11(14)10(13)5-8/h3-5,9,17H,2,6-7H2,1H3,(H2,15,16,18) |
| InChIKey | YSRRCPWKJWPFPI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |