C12H10ClFN2O — CID 80591814
N-[(3-chloro-4-fluorophenyl)methyl]-1-cyanocyclopropane-1-carboxamide (PubChem CID 80591814) has the molecular formula C12H10ClFN2O and a molecular weight of 252.68 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-1-cyanocyclopropane-1-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-1-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80591814 |
| Molecular Formula | C12H10ClFN2O |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-1-cyanocyclopropane-1-carboxamide |
| SMILES | N#CC1(C(=O)NCc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H10ClFN2O/c13-9-5-8(1-2-10(9)14)6-16-11(17)12(7-15)3-4-12/h1-2,5H,3-4,6H2,(H,16,17) |
| InChIKey | QZJTXNROSGFYDG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |