C13H12ClFN2O — CID 115183319
N-[(5-chloro-2-fluorophenyl)methyl]-1-cyanocyclobutane-1-carboxamide (PubChem CID 115183319) has the molecular formula C13H12ClFN2O and a molecular weight of 266.70 g/mol. Its IUPAC name is N-[(5-chloro-2-fluorophenyl)methyl]-1-cyanocyclobutane-1-carboxamide.
| Compound Name | N-[(5-chloro-2-fluorophenyl)methyl]-1-cyanocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115183319 |
| Molecular Formula | C13H12ClFN2O |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | N-[(5-chloro-2-fluorophenyl)methyl]-1-cyanocyclobutane-1-carboxamide |
| SMILES | N#CC1(C(=O)NCc2cc(Cl)ccc2F)CCC1 |
| InChI | InChI=1S/C13H12ClFN2O/c14-10-2-3-11(15)9(6-10)7-17-12(18)13(8-16)4-1-5-13/h2-3,6H,1,4-5,7H2,(H,17,18) |
| InChIKey | PDFPCDFZACVZFN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |