C16H17N3O — CID 61461994
1-cyano-N-[(4-cyanophenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 61461994) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-cyano-N-[(4-cyanophenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-cyano-N-[(4-cyanophenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 61461994 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-cyano-N-[(4-cyanophenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)C2(C#N)CCCCC2)cc1 |
| InChI | InChI=1S/C16H17N3O/c17-10-13-4-6-14(7-5-13)11-19-15(20)16(12-18)8-2-1-3-9-16/h4-7H,1-3,8-9,11H2,(H,19,20) |
| InChIKey | CZOOZBQWIFLPIQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |