C17H23N3O — CID 104677749
2-[1-(aminomethyl)cyclohexyl]-N-[(4-cyanophenyl)methyl]acetamide (PubChem CID 104677749) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]-N-[(4-cyanophenyl)methyl]acetamide.
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]-N-[(4-cyanophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 104677749 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]-N-[(4-cyanophenyl)methyl]acetamide |
| SMILES | N#Cc1ccc(CNC(=O)CC2(CN)CCCCC2)cc1 |
| InChI | InChI=1S/C17H23N3O/c18-11-14-4-6-15(7-5-14)12-20-16(21)10-17(13-19)8-2-1-3-9-17/h4-7H,1-3,8-10,12-13,19H2,(H,20,21) |
| InChIKey | ZGUHVSRKCDXTEK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |